About 2-acetyloxybenzoic acid;(E)-but-2-enedioic acid
2-acetyloxybenzoic acid;(E)-but-2-enedioic acid (PubChem CID 135328306) has the molecular formula C13H12O8
and a molecular weight of 296.23 g/mol. Its IUPAC name is 2-acetyloxybenzoic acid;(E)-but-2-enedioic acid.
Molecular Properties
| Compound Name | 2-acetyloxybenzoic acid;(E)-but-2-enedioic acid |
| PubChem CID | 135328306 |
| Molecular Formula | C13H12O8 |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-acetyloxybenzoic acid;(E)-but-2-enedioic acid |
| SMILES | CC(=O)Oc1ccccc1C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C9H8O4.C4H4O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;5-3(6)1-2-4(7)8/h2-5H,1H3,(H,11,12);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | HGQVFEIKICPRRQ-WLHGVMLRSA-N |
| XLogP | 1.02 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxybenzoic acid;(E)-but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxybenzoic acid;(E)-but-2-enedioic acid?
The IUPAC name of 2-acetyloxybenzoic acid;(E)-but-2-enedioic acid (CID 135328306) is 2-acetyloxybenzoic acid;(E)-but-2-enedioic acid.
What is the SMILES notation for 2-acetyloxybenzoic acid;(E)-but-2-enedioic acid?
The canonical SMILES for 2-acetyloxybenzoic acid;(E)-but-2-enedioic acid is CC(=O)Oc1ccccc1C(=O)O.O=C(O)/C=C/C(=O)O.
What is the InChIKey of 2-acetyloxybenzoic acid;(E)-but-2-enedioic acid?
The InChIKey is HGQVFEIKICPRRQ-WLHGVMLRSA-N. The full InChI is InChI=1S/C9H8O4.C4H4O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;5-3(6)1-2-4(7)8/h2-5H,1H3,(H,11,12);1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of 2-acetyloxybenzoic acid;(E)-but-2-enedioic acid?
2-acetyloxybenzoic acid;(E)-but-2-enedioic acid has a molecular weight of 296.23 g/mol, XLogP of 1.02, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxybenzoic acid;(E)-but-2-enedioic acid is sourced from PubChem (CID 135328306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).