About CID 67784645
CID 67784645 (PubChem CID 67784645) has the molecular formula C27H23O4Sn
and a molecular weight of 530.19 g/mol.
Molecular Properties
| Compound Name | CID 67784645 |
| PubChem CID | 67784645 |
| Molecular Formula | C27H23O4Sn |
| Molecular Weight | 530.19 g/mol |
| Exact Mass | 531.06 |
| IUPAC Name | — |
| SMILES | CC(=O)Oc1ccccc1C(=O)O.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C9H8O4.3C6H5.Sn/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;3*1-2-4-6-5-3-1;/h2-5H,1H3,(H,11,12);3*1-5H; |
| InChIKey | OOLXNVYZVGWNBC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 530.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze CID 67784645 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67784645?
The IUPAC name of CID 67784645 (CID 67784645) is not available.
What is the SMILES notation for CID 67784645?
The canonical SMILES for CID 67784645 is CC(=O)Oc1ccccc1C(=O)O.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of CID 67784645?
The InChIKey is OOLXNVYZVGWNBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4.3C6H5.Sn/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;3*1-2-4-6-5-3-1;/h2-5H,1H3,(H,11,12);3*1-5H;.
What are the key properties of CID 67784645?
CID 67784645 has a molecular weight of 530.19 g/mol, XLogP of 3.51, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67784645 is sourced from PubChem (CID 67784645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).