About 2-acetyloxybenzoic acid;ethene
2-acetyloxybenzoic acid;ethene (PubChem CID 67877309) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is 2-acetyloxybenzoic acid;ethene.
Molecular Properties
| Compound Name | 2-acetyloxybenzoic acid;ethene |
| PubChem CID | 67877309 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2-acetyloxybenzoic acid;ethene |
| SMILES | C=C.CC(=O)Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C9H8O4.C2H4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;1-2/h2-5H,1H3,(H,11,12);1-2H2 |
| InChIKey | WOFABLLRMZVRCB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxybenzoic acid;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxybenzoic acid;ethene?
The IUPAC name of 2-acetyloxybenzoic acid;ethene (CID 67877309) is 2-acetyloxybenzoic acid;ethene.
What is the SMILES notation for 2-acetyloxybenzoic acid;ethene?
The canonical SMILES for 2-acetyloxybenzoic acid;ethene is C=C.CC(=O)Oc1ccccc1C(=O)O.
What is the InChIKey of 2-acetyloxybenzoic acid;ethene?
The InChIKey is WOFABLLRMZVRCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4.C2H4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;1-2/h2-5H,1H3,(H,11,12);1-2H2.
What are the key properties of 2-acetyloxybenzoic acid;ethene?
2-acetyloxybenzoic acid;ethene has a molecular weight of 208.21 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxybenzoic acid;ethene is sourced from PubChem (CID 67877309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).