About calcium;2-acetyloxybenzoate;urea
calcium;2-acetyloxybenzoate;urea (PubChem CID 23618458) has the molecular formula C10H11CaN2O5+
and a molecular weight of 279.29 g/mol. Its IUPAC name is calcium;2-acetyloxybenzoate;urea.
Molecular Properties
| Compound Name | calcium;2-acetyloxybenzoate;urea |
| PubChem CID | 23618458 |
| Molecular Formula | C10H11CaN2O5+ |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | calcium;2-acetyloxybenzoate;urea |
| SMILES | CC(=O)Oc1ccccc1C(=O)[O-].NC(N)=O.[Ca+2] |
| InChI | InChI=1S/C9H8O4.CH4N2O.Ca/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;2-1(3)4;/h2-5H,1H3,(H,11,12);(H4,2,3,4);/q;;+2/p-1 |
| InChIKey | SKHBUMMBNIWWSP-UHFFFAOYSA-M |
| XLogP | -1.38 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze calcium;2-acetyloxybenzoate;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;2-acetyloxybenzoate;urea?
The IUPAC name of calcium;2-acetyloxybenzoate;urea (CID 23618458) is calcium;2-acetyloxybenzoate;urea.
What is the SMILES notation for calcium;2-acetyloxybenzoate;urea?
The canonical SMILES for calcium;2-acetyloxybenzoate;urea is CC(=O)Oc1ccccc1C(=O)[O-].NC(N)=O.[Ca+2].
What is the InChIKey of calcium;2-acetyloxybenzoate;urea?
The InChIKey is SKHBUMMBNIWWSP-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H8O4.CH4N2O.Ca/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;2-1(3)4;/h2-5H,1H3,(H,11,12);(H4,2,3,4);/q;;+2/p-1.
What are the key properties of calcium;2-acetyloxybenzoate;urea?
calcium;2-acetyloxybenzoate;urea has a molecular weight of 279.29 g/mol, XLogP of -1.38, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;2-acetyloxybenzoate;urea is sourced from PubChem (CID 23618458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).