About calcium;(carbamoylamino) 2-acetyloxybenzoate;hydride
calcium;(carbamoylamino) 2-acetyloxybenzoate;hydride (PubChem CID 174875643) has the molecular formula C10H12CaN2O5
and a molecular weight of 280.29 g/mol. Its IUPAC name is calcium;(carbamoylamino) 2-acetyloxybenzoate;hydride.
Molecular Properties
| Compound Name | calcium;(carbamoylamino) 2-acetyloxybenzoate;hydride |
| PubChem CID | 174875643 |
| Molecular Formula | C10H12CaN2O5 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | calcium;(carbamoylamino) 2-acetyloxybenzoate;hydride |
| SMILES | CC(=O)Oc1ccccc1C(=O)ONC(N)=O.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C10H10N2O5.Ca.2H/c1-6(13)16-8-5-3-2-4-7(8)9(14)17-12-10(11)15;;;/h2-5H,1H3,(H3,11,12,15);;;/q;+2;2*-1 |
| InChIKey | KIFJOCGZFYOXOL-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze calcium;(carbamoylamino) 2-acetyloxybenzoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;(carbamoylamino) 2-acetyloxybenzoate;hydride?
The IUPAC name of calcium;(carbamoylamino) 2-acetyloxybenzoate;hydride (CID 174875643) is calcium;(carbamoylamino) 2-acetyloxybenzoate;hydride.
What is the SMILES notation for calcium;(carbamoylamino) 2-acetyloxybenzoate;hydride?
The canonical SMILES for calcium;(carbamoylamino) 2-acetyloxybenzoate;hydride is CC(=O)Oc1ccccc1C(=O)ONC(N)=O.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;(carbamoylamino) 2-acetyloxybenzoate;hydride?
The InChIKey is KIFJOCGZFYOXOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O5.Ca.2H/c1-6(13)16-8-5-3-2-4-7(8)9(14)17-12-10(11)15;;;/h2-5H,1H3,(H3,11,12,15);;;/q;+2;2*-1.
What are the key properties of calcium;(carbamoylamino) 2-acetyloxybenzoate;hydride?
calcium;(carbamoylamino) 2-acetyloxybenzoate;hydride has a molecular weight of 280.29 g/mol, XLogP of 0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;(carbamoylamino) 2-acetyloxybenzoate;hydride is sourced from PubChem (CID 174875643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).