About 2-propanoyloxybenzoate
2-propanoyloxybenzoate (PubChem CID 23200401) has the molecular formula C10H9O4-
and a molecular weight of 193.18 g/mol. Its IUPAC name is 2-propanoyloxybenzoate.
Molecular Properties
| Compound Name | 2-propanoyloxybenzoate |
| PubChem CID | 23200401 |
| Molecular Formula | C10H9O4- |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 2-propanoyloxybenzoate |
| SMILES | CCC(=O)Oc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C10H10O4/c1-2-9(11)14-8-6-4-3-5-7(8)10(12)13/h3-6H,2H2,1H3,(H,12,13)/p-1 |
| InChIKey | MDLKHAVFIDFTBO-UHFFFAOYSA-M |
| XLogP | 0.37 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-propanoyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propanoyloxybenzoate?
The IUPAC name of 2-propanoyloxybenzoate (CID 23200401) is 2-propanoyloxybenzoate.
What is the SMILES notation for 2-propanoyloxybenzoate?
The canonical SMILES for 2-propanoyloxybenzoate is CCC(=O)Oc1ccccc1C(=O)[O-].
What is the InChIKey of 2-propanoyloxybenzoate?
The InChIKey is MDLKHAVFIDFTBO-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H10O4/c1-2-9(11)14-8-6-4-3-5-7(8)10(12)13/h3-6H,2H2,1H3,(H,12,13)/p-1.
What are the key properties of 2-propanoyloxybenzoate?
2-propanoyloxybenzoate has a molecular weight of 193.18 g/mol, XLogP of 0.37, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propanoyloxybenzoate is sourced from PubChem (CID 23200401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).