About (2-hydroxyphenyl) 2-(2-propanoyloxyphenyl)prop-2-enoate;hydrochloride
(2-hydroxyphenyl) 2-(2-propanoyloxyphenyl)prop-2-enoate;hydrochloride (PubChem CID 141066516) has the molecular formula C18H17ClO5
and a molecular weight of 348.78 g/mol. Its IUPAC name is (2-hydroxyphenyl) 2-(2-propanoyloxyphenyl)prop-2-enoate;hydrochloride.
Molecular Properties
| Compound Name | (2-hydroxyphenyl) 2-(2-propanoyloxyphenyl)prop-2-enoate;hydrochloride |
| PubChem CID | 141066516 |
| Molecular Formula | C18H17ClO5 |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (2-hydroxyphenyl) 2-(2-propanoyloxyphenyl)prop-2-enoate;hydrochloride |
| SMILES | C=C(C(=O)Oc1ccccc1O)c1ccccc1OC(=O)CC.Cl |
| InChI | InChI=1S/C18H16O5.ClH/c1-3-17(20)22-15-10-6-4-8-13(15)12(2)18(21)23-16-11-7-5-9-14(16)19;/h4-11,19H,2-3H2,1H3;1H |
| InChIKey | FCCYPKUUCMLJAT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxyphenyl) 2-(2-propanoyloxyphenyl)prop-2-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxyphenyl) 2-(2-propanoyloxyphenyl)prop-2-enoate;hydrochloride?
The IUPAC name of (2-hydroxyphenyl) 2-(2-propanoyloxyphenyl)prop-2-enoate;hydrochloride (CID 141066516) is (2-hydroxyphenyl) 2-(2-propanoyloxyphenyl)prop-2-enoate;hydrochloride.
What is the SMILES notation for (2-hydroxyphenyl) 2-(2-propanoyloxyphenyl)prop-2-enoate;hydrochloride?
The canonical SMILES for (2-hydroxyphenyl) 2-(2-propanoyloxyphenyl)prop-2-enoate;hydrochloride is C=C(C(=O)Oc1ccccc1O)c1ccccc1OC(=O)CC.Cl.
What is the InChIKey of (2-hydroxyphenyl) 2-(2-propanoyloxyphenyl)prop-2-enoate;hydrochloride?
The InChIKey is FCCYPKUUCMLJAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O5.ClH/c1-3-17(20)22-15-10-6-4-8-13(15)12(2)18(21)23-16-11-7-5-9-14(16)19;/h4-11,19H,2-3H2,1H3;1H.
What are the key properties of (2-hydroxyphenyl) 2-(2-propanoyloxyphenyl)prop-2-enoate;hydrochloride?
(2-hydroxyphenyl) 2-(2-propanoyloxyphenyl)prop-2-enoate;hydrochloride has a molecular weight of 348.78 g/mol, XLogP of 3.75, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxyphenyl) 2-(2-propanoyloxyphenyl)prop-2-enoate;hydrochloride is sourced from PubChem (CID 141066516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).