About (2-hydroxyphenyl) 2-hydroxyacetate
(2-hydroxyphenyl) 2-hydroxyacetate (PubChem CID 54356800) has the molecular formula C8H8O4
and a molecular weight of 168.15 g/mol. Its IUPAC name is (2-hydroxyphenyl) 2-hydroxyacetate.
Molecular Properties
| Compound Name | (2-hydroxyphenyl) 2-hydroxyacetate |
| PubChem CID | 54356800 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | (2-hydroxyphenyl) 2-hydroxyacetate |
| SMILES | O=C(CO)Oc1ccccc1O |
| InChI | InChI=1S/C8H8O4/c9-5-8(11)12-7-4-2-1-3-6(7)10/h1-4,9-10H,5H2 |
| InChIKey | UJQUSUKKFFVEBS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxyphenyl) 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxyphenyl) 2-hydroxyacetate?
The IUPAC name of (2-hydroxyphenyl) 2-hydroxyacetate (CID 54356800) is (2-hydroxyphenyl) 2-hydroxyacetate.
What is the SMILES notation for (2-hydroxyphenyl) 2-hydroxyacetate?
The canonical SMILES for (2-hydroxyphenyl) 2-hydroxyacetate is O=C(CO)Oc1ccccc1O.
What is the InChIKey of (2-hydroxyphenyl) 2-hydroxyacetate?
The InChIKey is UJQUSUKKFFVEBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4/c9-5-8(11)12-7-4-2-1-3-6(7)10/h1-4,9-10H,5H2.
What are the key properties of (2-hydroxyphenyl) 2-hydroxyacetate?
(2-hydroxyphenyl) 2-hydroxyacetate has a molecular weight of 168.15 g/mol, XLogP of 0.29, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxyphenyl) 2-hydroxyacetate is sourced from PubChem (CID 54356800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).