About (2-hydroxyphenyl) 4-chlorobutanoate
(2-hydroxyphenyl) 4-chlorobutanoate (PubChem CID 69126445) has the molecular formula C10H11ClO3
and a molecular weight of 214.65 g/mol. Its IUPAC name is (2-hydroxyphenyl) 4-chlorobutanoate.
Molecular Properties
| Compound Name | (2-hydroxyphenyl) 4-chlorobutanoate |
| PubChem CID | 69126445 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | (2-hydroxyphenyl) 4-chlorobutanoate |
| SMILES | O=C(CCCCl)Oc1ccccc1O |
| InChI | InChI=1S/C10H11ClO3/c11-7-3-6-10(13)14-9-5-2-1-4-8(9)12/h1-2,4-5,12H,3,6-7H2 |
| InChIKey | KOQBKAQXCCFBNQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxyphenyl) 4-chlorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxyphenyl) 4-chlorobutanoate?
The IUPAC name of (2-hydroxyphenyl) 4-chlorobutanoate (CID 69126445) is (2-hydroxyphenyl) 4-chlorobutanoate.
What is the SMILES notation for (2-hydroxyphenyl) 4-chlorobutanoate?
The canonical SMILES for (2-hydroxyphenyl) 4-chlorobutanoate is O=C(CCCCl)Oc1ccccc1O.
What is the InChIKey of (2-hydroxyphenyl) 4-chlorobutanoate?
The InChIKey is KOQBKAQXCCFBNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO3/c11-7-3-6-10(13)14-9-5-2-1-4-8(9)12/h1-2,4-5,12H,3,6-7H2.
What are the key properties of (2-hydroxyphenyl) 4-chlorobutanoate?
(2-hydroxyphenyl) 4-chlorobutanoate has a molecular weight of 214.65 g/mol, XLogP of 2.32, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxyphenyl) 4-chlorobutanoate is sourced from PubChem (CID 69126445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).