C18H14ClF3O4 — CID 91723500
[2-(5-chloropentanoyloxy)phenyl] 2,3,4-trifluorobenzoate (PubChem CID 91723500) has the molecular formula C18H14ClF3O4 and a molecular weight of 386.75 g/mol. Its IUPAC name is [2-(5-chloropentanoyloxy)phenyl] 2,3,4-trifluorobenzoate.
| Compound Name | [2-(5-chloropentanoyloxy)phenyl] 2,3,4-trifluorobenzoate |
|---|---|
| PubChem CID | 91723500 |
| Molecular Formula | C18H14ClF3O4 |
| Molecular Weight | 386.75 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | [2-(5-chloropentanoyloxy)phenyl] 2,3,4-trifluorobenzoate |
| SMILES | O=C(CCCCCl)Oc1ccccc1OC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H14ClF3O4/c19-10-4-3-7-15(23)25-13-5-1-2-6-14(13)26-18(24)11-8-9-12(20)17(22)16(11)21/h1-2,5-6,8-9H,3-4,7,10H2 |
| InChIKey | RPTONSYVNRBIOS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.75 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|