C7H3F3O3 — CID 87231779
2,3,4-trifluorobenzenecarboperoxoic acid (PubChem CID 87231779) has the molecular formula C7H3F3O3 and a molecular weight of 192.09 g/mol. Its IUPAC name is 2,3,4-trifluorobenzenecarboperoxoic acid.
| Compound Name | 2,3,4-trifluorobenzenecarboperoxoic acid |
|---|---|
| PubChem CID | 87231779 |
| Molecular Formula | C7H3F3O3 |
| Molecular Weight | 192.09 g/mol |
| Exact Mass | 192.00 |
| IUPAC Name | 2,3,4-trifluorobenzenecarboperoxoic acid |
| SMILES | O=C(OO)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C7H3F3O3/c8-4-2-1-3(7(11)13-12)5(9)6(4)10/h1-2,12H |
| InChIKey | RPNPBQOZJYOMDH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.09 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|