2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid

C9H3F5O2 — CID 53425745

IUPAC2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid
SMILESO=C(O)C(F)=C(F)c1ccc(F)c(F)c1F
InChIInChI=1S/C9H3F5O2/c10-4-2-1-3(5(11)7(4)13)6(12)8(14)9(15)16/h1-2H,(H,15,16)
InChIKeyVKXWVYSJVCRITA-UHFFFAOYSA-N
MW238.11 g/mol
LogP2.80
Rot. Bonds2

About 2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid

2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid (PubChem CID 53425745) has the molecular formula C9H3F5O2 and a molecular weight of 238.11 g/mol. Its IUPAC name is 2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid.

Molecular Properties

Compound Name2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid
PubChem CID53425745
Molecular FormulaC9H3F5O2
Molecular Weight238.11 g/mol
Exact Mass238.01
IUPAC Name2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid
SMILESO=C(O)C(F)=C(F)c1ccc(F)c(F)c1F
InChIInChI=1S/C9H3F5O2/c10-4-2-1-3(5(11)7(4)13)6(12)8(14)9(15)16/h1-2H,(H,15,16)
InChIKeyVKXWVYSJVCRITA-UHFFFAOYSA-N
XLogP2.80
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.11
LogP ≤ 52.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid?
The IUPAC name of 2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid (CID 53425745) is 2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid.
What is the SMILES notation for 2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid?
The canonical SMILES for 2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid is O=C(O)C(F)=C(F)c1ccc(F)c(F)c1F.
What is the InChIKey of 2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid?
The InChIKey is VKXWVYSJVCRITA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3F5O2/c10-4-2-1-3(5(11)7(4)13)6(12)8(14)9(15)16/h1-2H,(H,15,16).
What are the key properties of 2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid?
2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid has a molecular weight of 238.11 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-3-(2,3,4-trifluorophenyl)prop-2-enoic acid is sourced from PubChem (CID 53425745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).