C13H6BrF3O — CID 62963924
(4-bromophenyl)-(2,3,4-trifluorophenyl)methanone (PubChem CID 62963924) has the molecular formula C13H6BrF3O and a molecular weight of 315.09 g/mol. Its IUPAC name is (4-bromophenyl)-(2,3,4-trifluorophenyl)methanone.
| Compound Name | (4-bromophenyl)-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 62963924 |
| Molecular Formula | C13H6BrF3O |
| Molecular Weight | 315.09 g/mol |
| Exact Mass | 313.96 |
| IUPAC Name | (4-bromophenyl)-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(Br)cc1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H6BrF3O/c14-8-3-1-7(2-4-8)13(18)9-5-6-10(15)12(17)11(9)16/h1-6H |
| InChIKey | JKTLEGUPUQLPPT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.09 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|