C17H13F3O — CID 115807772
(4-cyclobutylphenyl)-(2,3,4-trifluorophenyl)methanone (PubChem CID 115807772) has the molecular formula C17H13F3O and a molecular weight of 290.28 g/mol. Its IUPAC name is (4-cyclobutylphenyl)-(2,3,4-trifluorophenyl)methanone.
| Compound Name | (4-cyclobutylphenyl)-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 115807772 |
| Molecular Formula | C17H13F3O |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (4-cyclobutylphenyl)-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(C2CCC2)cc1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H13F3O/c18-14-9-8-13(15(19)16(14)20)17(21)12-6-4-11(5-7-12)10-2-1-3-10/h4-10H,1-3H2 |
| InChIKey | JQCABHKWIAFLPE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|