C15H12Br2OS — CID 107967818
(4-cyclobutylphenyl)-(2,5-dibromothiophen-3-yl)methanone (PubChem CID 107967818) has the molecular formula C15H12Br2OS and a molecular weight of 400.14 g/mol. Its IUPAC name is (4-cyclobutylphenyl)-(2,5-dibromothiophen-3-yl)methanone.
| Compound Name | (4-cyclobutylphenyl)-(2,5-dibromothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 107967818 |
| Molecular Formula | C15H12Br2OS |
| Molecular Weight | 400.14 g/mol |
| Exact Mass | 397.90 |
| IUPAC Name | (4-cyclobutylphenyl)-(2,5-dibromothiophen-3-yl)methanone |
| SMILES | O=C(c1ccc(C2CCC2)cc1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C15H12Br2OS/c16-13-8-12(15(17)19-13)14(18)11-6-4-10(5-7-11)9-2-1-3-9/h4-9H,1-3H2 |
| InChIKey | ALVGQNPRXPHAKI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.14 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |