C11H5Br2ClOS — CID 43344984
(4-chlorophenyl)-(2,5-dibromothiophen-3-yl)methanone (PubChem CID 43344984) has the molecular formula C11H5Br2ClOS and a molecular weight of 380.49 g/mol. Its IUPAC name is (4-chlorophenyl)-(2,5-dibromothiophen-3-yl)methanone.
| Compound Name | (4-chlorophenyl)-(2,5-dibromothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 43344984 |
| Molecular Formula | C11H5Br2ClOS |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 377.81 |
| IUPAC Name | (4-chlorophenyl)-(2,5-dibromothiophen-3-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C11H5Br2ClOS/c12-9-5-8(11(13)16-9)10(15)6-1-3-7(14)4-2-6/h1-5H |
| InChIKey | IIZFGKAWQDLYEP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |