C9H4Br2O2S — CID 43463819
(2,5-dibromothiophen-3-yl)-(furan-3-yl)methanone (PubChem CID 43463819) has the molecular formula C9H4Br2O2S and a molecular weight of 336.00 g/mol. Its IUPAC name is (2,5-dibromothiophen-3-yl)-(furan-3-yl)methanone.
| Compound Name | (2,5-dibromothiophen-3-yl)-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 43463819 |
| Molecular Formula | C9H4Br2O2S |
| Molecular Weight | 336.00 g/mol |
| Exact Mass | 333.83 |
| IUPAC Name | (2,5-dibromothiophen-3-yl)-(furan-3-yl)methanone |
| SMILES | O=C(c1ccoc1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H4Br2O2S/c10-7-3-6(9(11)14-7)8(12)5-1-2-13-4-5/h1-4H |
| InChIKey | UFCZOLQQSYRXGM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.00 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |