C12H14Br2OS — CID 63491664
cycloheptyl-(2,5-dibromothiophen-3-yl)methanone (PubChem CID 63491664) has the molecular formula C12H14Br2OS and a molecular weight of 366.12 g/mol. Its IUPAC name is cycloheptyl-(2,5-dibromothiophen-3-yl)methanone.
| Compound Name | cycloheptyl-(2,5-dibromothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 63491664 |
| Molecular Formula | C12H14Br2OS |
| Molecular Weight | 366.12 g/mol |
| Exact Mass | 363.91 |
| IUPAC Name | cycloheptyl-(2,5-dibromothiophen-3-yl)methanone |
| SMILES | O=C(c1cc(Br)sc1Br)C1CCCCCC1 |
| InChI | InChI=1S/C12H14Br2OS/c13-10-7-9(12(14)16-10)11(15)8-5-3-1-2-4-6-8/h7-8H,1-6H2 |
| InChIKey | SLZHJYALIDPKJM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.12 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |