C11H13Br2NOS — CID 43227146
1-(2,5-dibromothiophen-3-yl)-2-piperidin-1-ylethanone (PubChem CID 43227146) has the molecular formula C11H13Br2NOS and a molecular weight of 367.11 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-piperidin-1-ylethanone.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 43227146 |
| Molecular Formula | C11H13Br2NOS |
| Molecular Weight | 367.11 g/mol |
| Exact Mass | 364.91 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-piperidin-1-ylethanone |
| SMILES | O=C(CN1CCCCC1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C11H13Br2NOS/c12-10-6-8(11(13)16-10)9(15)7-14-4-2-1-3-5-14/h6H,1-5,7H2 |
| InChIKey | IXQQAZNXKPSQQE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.11 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |