C13H13Br2NO3S — CID 62935317
1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-4,4-dimethylpiperidine-2,6-dione (PubChem CID 62935317) has the molecular formula C13H13Br2NO3S and a molecular weight of 423.13 g/mol. Its IUPAC name is 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-4,4-dimethylpiperidine-2,6-dione.
| Compound Name | 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-4,4-dimethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 62935317 |
| Molecular Formula | C13H13Br2NO3S |
| Molecular Weight | 423.13 g/mol |
| Exact Mass | 420.90 |
| IUPAC Name | 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]-4,4-dimethylpiperidine-2,6-dione |
| SMILES | CC1(C)CC(=O)N(CC(=O)c2cc(Br)sc2Br)C(=O)C1 |
| InChI | InChI=1S/C13H13Br2NO3S/c1-13(2)4-10(18)16(11(19)5-13)6-8(17)7-3-9(14)20-12(7)15/h3H,4-6H2,1-2H3 |
| InChIKey | JJTPAQHMJVROSL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.13 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|