C11H11Br2NO2S — CID 62051251
1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]piperidin-4-one (PubChem CID 62051251) has the molecular formula C11H11Br2NO2S and a molecular weight of 381.09 g/mol. Its IUPAC name is 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]piperidin-4-one.
| Compound Name | 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]piperidin-4-one |
|---|---|
| PubChem CID | 62051251 |
| Molecular Formula | C11H11Br2NO2S |
| Molecular Weight | 381.09 g/mol |
| Exact Mass | 378.89 |
| IUPAC Name | 1-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]piperidin-4-one |
| SMILES | O=C1CCN(CC(=O)c2cc(Br)sc2Br)CC1 |
| InChI | InChI=1S/C11H11Br2NO2S/c12-10-5-8(11(13)17-10)9(16)6-14-3-1-7(15)2-4-14/h5H,1-4,6H2 |
| InChIKey | BADNOKWJMWCJLK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.09 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |