C7H6Br2O3S2 — CID 62784747
1-(2,5-dibromothiophen-3-yl)-2-methylsulfonylethanone (PubChem CID 62784747) has the molecular formula C7H6Br2O3S2 and a molecular weight of 362.06 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-methylsulfonylethanone.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-methylsulfonylethanone |
|---|---|
| PubChem CID | 62784747 |
| Molecular Formula | C7H6Br2O3S2 |
| Molecular Weight | 362.06 g/mol |
| Exact Mass | 359.81 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-methylsulfonylethanone |
| SMILES | CS(=O)(=O)CC(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C7H6Br2O3S2/c1-14(11,12)3-5(10)4-2-6(8)13-7(4)9/h2H,3H2,1H3 |
| InChIKey | WQZIPQKACABTQY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.06 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |