C9H10Br2O3S2 — CID 64644308
1-(2,5-dibromothiophen-3-yl)-2-propylsulfonylethanone (PubChem CID 64644308) has the molecular formula C9H10Br2O3S2 and a molecular weight of 390.12 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-propylsulfonylethanone.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-propylsulfonylethanone |
|---|---|
| PubChem CID | 64644308 |
| Molecular Formula | C9H10Br2O3S2 |
| Molecular Weight | 390.12 g/mol |
| Exact Mass | 387.84 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-propylsulfonylethanone |
| SMILES | CCCS(=O)(=O)CC(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H10Br2O3S2/c1-2-3-16(13,14)5-7(12)6-4-8(10)15-9(6)11/h4H,2-3,5H2,1H3 |
| InChIKey | BYQUFVUNNZIZGQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.12 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |