C15H19Br2NOS — CID 43228989
2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-1-(2,5-dibromothiophen-3-yl)ethanone (PubChem CID 43228989) has the molecular formula C15H19Br2NOS and a molecular weight of 421.20 g/mol. Its IUPAC name is 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-1-(2,5-dibromothiophen-3-yl)ethanone.
| Compound Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-1-(2,5-dibromothiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 43228989 |
| Molecular Formula | C15H19Br2NOS |
| Molecular Weight | 421.20 g/mol |
| Exact Mass | 418.96 |
| IUPAC Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-1-(2,5-dibromothiophen-3-yl)ethanone |
| SMILES | O=C(CN1CCC2CCCCC2C1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C15H19Br2NOS/c16-14-7-12(15(17)20-14)13(19)9-18-6-5-10-3-1-2-4-11(10)8-18/h7,10-11H,1-6,8-9H2 |
| InChIKey | VQVXHXFAECZGIH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.20 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |