C13H15NO4 — CID 60650473
1-[2-(2,4-dihydroxyphenyl)-2-oxoethyl]piperidin-4-one (PubChem CID 60650473) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-[2-(2,4-dihydroxyphenyl)-2-oxoethyl]piperidin-4-one.
| Compound Name | 1-[2-(2,4-dihydroxyphenyl)-2-oxoethyl]piperidin-4-one |
|---|---|
| PubChem CID | 60650473 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-[2-(2,4-dihydroxyphenyl)-2-oxoethyl]piperidin-4-one |
| SMILES | O=C1CCN(CC(=O)c2ccc(O)cc2O)CC1 |
| InChI | InChI=1S/C13H15NO4/c15-9-3-5-14(6-4-9)8-13(18)11-2-1-10(16)7-12(11)17/h1-2,7,16-17H,3-6,8H2 |
| InChIKey | GBGSEBIKDPKAER-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |