C13H18N2O3 — CID 62036900
2-(3-aminopiperidin-1-yl)-1-(2,4-dihydroxyphenyl)ethanone (PubChem CID 62036900) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-(3-aminopiperidin-1-yl)-1-(2,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-(3-aminopiperidin-1-yl)-1-(2,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 62036900 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-(3-aminopiperidin-1-yl)-1-(2,4-dihydroxyphenyl)ethanone |
| SMILES | NC1CCCN(CC(=O)c2ccc(O)cc2O)C1 |
| InChI | InChI=1S/C13H18N2O3/c14-9-2-1-5-15(7-9)8-13(18)11-4-3-10(16)6-12(11)17/h3-4,6,9,16-17H,1-2,5,7-8,14H2 |
| InChIKey | XVNFRUJGGDCVAN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |