C13H14ClNO3S — CID 55156736
1-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-4,4-dimethylpiperidine-2,6-dione (PubChem CID 55156736) has the molecular formula C13H14ClNO3S and a molecular weight of 299.78 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-4,4-dimethylpiperidine-2,6-dione.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-4,4-dimethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 55156736 |
| Molecular Formula | C13H14ClNO3S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-4,4-dimethylpiperidine-2,6-dione |
| SMILES | CC1(C)CC(=O)N(CC(=O)c2ccc(Cl)s2)C(=O)C1 |
| InChI | InChI=1S/C13H14ClNO3S/c1-13(2)5-11(17)15(12(18)6-13)7-8(16)9-3-4-10(14)19-9/h3-4H,5-7H2,1-2H3 |
| InChIKey | YPRARXREQNIEIZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|