C12H15Cl2NOS — CID 43227260
2-(azepan-1-yl)-1-(2,5-dichlorothiophen-3-yl)ethanone (PubChem CID 43227260) has the molecular formula C12H15Cl2NOS and a molecular weight of 292.23 g/mol. Its IUPAC name is 2-(azepan-1-yl)-1-(2,5-dichlorothiophen-3-yl)ethanone.
| Compound Name | 2-(azepan-1-yl)-1-(2,5-dichlorothiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 43227260 |
| Molecular Formula | C12H15Cl2NOS |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-(azepan-1-yl)-1-(2,5-dichlorothiophen-3-yl)ethanone |
| SMILES | O=C(CN1CCCCCC1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H15Cl2NOS/c13-11-7-9(12(14)17-11)10(16)8-15-5-3-1-2-4-6-15/h7H,1-6,8H2 |
| InChIKey | SZFOABLNDAHUPH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |