C15H19Cl2NO2S — CID 81097946
2-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-1-(2,5-dichlorothiophen-3-yl)ethanone (PubChem CID 81097946) has the molecular formula C15H19Cl2NO2S and a molecular weight of 348.30 g/mol. Its IUPAC name is 2-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-1-(2,5-dichlorothiophen-3-yl)ethanone.
| Compound Name | 2-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-1-(2,5-dichlorothiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 81097946 |
| Molecular Formula | C15H19Cl2NO2S |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 2-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-1-(2,5-dichlorothiophen-3-yl)ethanone |
| SMILES | O=C(CN1CCC2(O)CCCCC2C1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C15H19Cl2NO2S/c16-13-7-11(14(17)21-13)12(19)9-18-6-5-15(20)4-2-1-3-10(15)8-18/h7,10,20H,1-6,8-9H2 |
| InChIKey | MMXMNKVYCNQYMT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |