C11H14Cl2N2OS — CID 60710450
2-(1,4-diazepan-1-yl)-1-(2,5-dichlorothiophen-3-yl)ethanone (PubChem CID 60710450) has the molecular formula C11H14Cl2N2OS and a molecular weight of 293.22 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-1-(2,5-dichlorothiophen-3-yl)ethanone.
| Compound Name | 2-(1,4-diazepan-1-yl)-1-(2,5-dichlorothiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 60710450 |
| Molecular Formula | C11H14Cl2N2OS |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-1-(2,5-dichlorothiophen-3-yl)ethanone |
| SMILES | O=C(CN1CCCNCC1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H14Cl2N2OS/c12-10-6-8(11(13)17-10)9(16)7-15-4-1-2-14-3-5-15/h6,14H,1-5,7H2 |
| InChIKey | PORNRSLFLHRDAH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |