C9H10Cl2N2OS — CID 103629624
(2,5-dichlorothiophen-3-yl)-piperazin-1-ylmethanone (PubChem CID 103629624) has the molecular formula C9H10Cl2N2OS and a molecular weight of 265.16 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)-piperazin-1-ylmethanone.
| Compound Name | (2,5-dichlorothiophen-3-yl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 103629624 |
| Molecular Formula | C9H10Cl2N2OS |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)-piperazin-1-ylmethanone |
| SMILES | O=C(c1cc(Cl)sc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C9H10Cl2N2OS/c10-7-5-6(8(11)15-7)9(14)13-3-1-12-2-4-13/h5,12H,1-4H2 |
| InChIKey | VEOGIHGLAUCJJM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |