C9H11Cl2N3O3S2 — CID 95979713
4-(2,5-dichlorothiophene-3-carbonyl)piperazine-1-sulfonamide (PubChem CID 95979713) has the molecular formula C9H11Cl2N3O3S2 and a molecular weight of 344.25 g/mol. Its IUPAC name is 4-(2,5-dichlorothiophene-3-carbonyl)piperazine-1-sulfonamide.
| Compound Name | 4-(2,5-dichlorothiophene-3-carbonyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 95979713 |
| Molecular Formula | C9H11Cl2N3O3S2 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | 4-(2,5-dichlorothiophene-3-carbonyl)piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(C(=O)c2cc(Cl)sc2Cl)CC1 |
| InChI | InChI=1S/C9H11Cl2N3O3S2/c10-7-5-6(8(11)18-7)9(15)13-1-3-14(4-2-13)19(12,16)17/h5H,1-4H2,(H2,12,16,17) |
| InChIKey | VOBJTXLFSNKWJH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |