C10H10Cl2N2O2S — CID 107962407
(2,5-dichlorothiophen-3-yl)-(4-hydroxyiminopiperidin-1-yl)methanone (PubChem CID 107962407) has the molecular formula C10H10Cl2N2O2S and a molecular weight of 293.18 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)-(4-hydroxyiminopiperidin-1-yl)methanone.
| Compound Name | (2,5-dichlorothiophen-3-yl)-(4-hydroxyiminopiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 107962407 |
| Molecular Formula | C10H10Cl2N2O2S |
| Molecular Weight | 293.18 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)-(4-hydroxyiminopiperidin-1-yl)methanone |
| SMILES | O=C(c1cc(Cl)sc1Cl)N1CCC(=NO)CC1 |
| InChI | InChI=1S/C10H10Cl2N2O2S/c11-8-5-7(9(12)17-8)10(15)14-3-1-6(13-16)2-4-14/h5,16H,1-4H2 |
| InChIKey | SVQNSOYVAKPLEO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.18 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|