C14H12Cl2N2OS — CID 107963575
(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(2,5-dichlorothiophen-3-yl)methanone (PubChem CID 107963575) has the molecular formula C14H12Cl2N2OS and a molecular weight of 327.24 g/mol. Its IUPAC name is (5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(2,5-dichlorothiophen-3-yl)methanone.
| Compound Name | (5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(2,5-dichlorothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 107963575 |
| Molecular Formula | C14H12Cl2N2OS |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | (5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(2,5-dichlorothiophen-3-yl)methanone |
| SMILES | Nc1cccc2c1CCN(C(=O)c1cc(Cl)sc1Cl)C2 |
| InChI | InChI=1S/C14H12Cl2N2OS/c15-12-6-10(13(16)20-12)14(19)18-5-4-9-8(7-18)2-1-3-11(9)17/h1-3,6H,4-5,7,17H2 |
| InChIKey | IWUCQQCDWLDZOS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|