C15H14ClN3O — CID 66483208
(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(3-chloro-4-pyridinyl)methanone (PubChem CID 66483208) has the molecular formula C15H14ClN3O and a molecular weight of 287.75 g/mol. Its IUPAC name is (5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(3-chloro-4-pyridinyl)methanone.
| Compound Name | (5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(3-chloro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 66483208 |
| Molecular Formula | C15H14ClN3O |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (5-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(3-chloro-4-pyridinyl)methanone |
| SMILES | Nc1cccc2c1CCN(C(=O)c1ccncc1Cl)C2 |
| InChI | InChI=1S/C15H14ClN3O/c16-13-8-18-6-4-12(13)15(20)19-7-5-11-10(9-19)2-1-3-14(11)17/h1-4,6,8H,5,7,9,17H2 |
| InChIKey | UFJSLTVQLPTYMX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|