C14H14N4O — CID 114522694
(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-pyridazin-4-ylmethanone (PubChem CID 114522694) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is (8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-pyridazin-4-ylmethanone.
| Compound Name | (8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-pyridazin-4-ylmethanone |
|---|---|
| PubChem CID | 114522694 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-pyridazin-4-ylmethanone |
| SMILES | Nc1cccc2c1CN(C(=O)c1ccnnc1)CC2 |
| InChI | InChI=1S/C14H14N4O/c15-13-3-1-2-10-5-7-18(9-12(10)13)14(19)11-4-6-16-17-8-11/h1-4,6,8H,5,7,9,15H2 |
| InChIKey | QZHGHLZTDAXBKR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|