C14H16N4O — CID 103121100
(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(1-methylpyrazol-3-yl)methanone (PubChem CID 103121100) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is (8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(1-methylpyrazol-3-yl)methanone.
| Compound Name | (8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(1-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 103121100 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(1-methylpyrazol-3-yl)methanone |
| SMILES | Cn1ccc(C(=O)N2CCc3cccc(N)c3C2)n1 |
| InChI | InChI=1S/C14H16N4O/c1-17-7-6-13(16-17)14(19)18-8-5-10-3-2-4-12(15)11(10)9-18/h2-4,6-7H,5,8-9,15H2,1H3 |
| InChIKey | HWNGWZAXIYHHKR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|