C15H15N3O — CID 114523309
(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-pyridin-2-ylmethanone (PubChem CID 114523309) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is (8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-pyridin-2-ylmethanone.
| Compound Name | (8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 114523309 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-pyridin-2-ylmethanone |
| SMILES | Nc1cccc2c1CN(C(=O)c1ccccn1)CC2 |
| InChI | InChI=1S/C15H15N3O/c16-13-5-3-4-11-7-9-18(10-12(11)13)15(19)14-6-1-2-8-17-14/h1-6,8H,7,9-10,16H2 |
| InChIKey | NAJMQTZKRVBCCD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|