C17H15N3O — CID 114523287
3-(8-amino-3,4-dihydro-1H-isoquinoline-2-carbonyl)benzonitrile (PubChem CID 114523287) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 3-(8-amino-3,4-dihydro-1H-isoquinoline-2-carbonyl)benzonitrile.
| Compound Name | 3-(8-amino-3,4-dihydro-1H-isoquinoline-2-carbonyl)benzonitrile |
|---|---|
| PubChem CID | 114523287 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 3-(8-amino-3,4-dihydro-1H-isoquinoline-2-carbonyl)benzonitrile |
| SMILES | N#Cc1cccc(C(=O)N2CCc3cccc(N)c3C2)c1 |
| InChI | InChI=1S/C17H15N3O/c18-10-12-3-1-5-14(9-12)17(21)20-8-7-13-4-2-6-16(19)15(13)11-20/h1-6,9H,7-8,11,19H2 |
| InChIKey | ZXZZCKAXMXISOG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|