C18H17N3O3S — CID 110644273
2-(3-cyanobenzoyl)-N-methyl-3,4-dihydro-1H-isoquinoline-7-sulfonamide (PubChem CID 110644273) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-(3-cyanobenzoyl)-N-methyl-3,4-dihydro-1H-isoquinoline-7-sulfonamide.
| Compound Name | 2-(3-cyanobenzoyl)-N-methyl-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 110644273 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-(3-cyanobenzoyl)-N-methyl-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)CN(C(=O)c1cccc(C#N)c1)CC2 |
| InChI | InChI=1S/C18H17N3O3S/c1-20-25(23,24)17-6-5-14-7-8-21(12-16(14)10-17)18(22)15-4-2-3-13(9-15)11-19/h2-6,9-10,20H,7-8,12H2,1H3 |
| InChIKey | FZXQLYSBTPWJHJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |