C17H17N3 — CID 114522523
3-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile (PubChem CID 114522523) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile.
| Compound Name | 3-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 114522523 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2CCc3cccc(N)c3C2)c1 |
| InChI | InChI=1S/C17H17N3/c18-10-13-3-1-4-14(9-13)11-20-8-7-15-5-2-6-17(19)16(15)12-20/h1-6,9H,7-8,11-12,19H2 |
| InChIKey | GELCYLUGUSQKEY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|