About 2-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile
2-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile (PubChem CID 114523963) has the molecular formula C17H17N3
and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 2-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile |
| PubChem CID | 114523963 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1CCc2cccc(N)c2C1 |
| InChI | InChI=1S/C17H17N3/c18-10-14-4-1-2-5-15(14)11-20-9-8-13-6-3-7-17(19)16(13)12-20/h1-7H,8-9,11-12,19H2 |
| InChIKey | DGTVDBIWFINTGO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile?
The IUPAC name of 2-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile (CID 114523963) is 2-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile.
What is the SMILES notation for 2-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile?
The canonical SMILES for 2-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile is N#Cc1ccccc1CN1CCc2cccc(N)c2C1.
What is the InChIKey of 2-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile?
The InChIKey is DGTVDBIWFINTGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3/c18-10-14-4-1-2-5-15(14)11-20-9-8-13-6-3-7-17(19)16(13)12-20/h1-7H,8-9,11-12,19H2.
What are the key properties of 2-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile?
2-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile has a molecular weight of 263.34 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzonitrile is sourced from PubChem (CID 114523963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).