C16H16BrClN2 — CID 114522273
2-[(2-bromo-4-chlorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 114522273) has the molecular formula C16H16BrClN2 and a molecular weight of 351.68 g/mol. Its IUPAC name is 2-[(2-bromo-4-chlorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine.
| Compound Name | 2-[(2-bromo-4-chlorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine |
|---|---|
| PubChem CID | 114522273 |
| Molecular Formula | C16H16BrClN2 |
| Molecular Weight | 351.68 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 2-[(2-bromo-4-chlorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | Nc1cccc2c1CN(Cc1ccc(Cl)cc1Br)CC2 |
| InChI | InChI=1S/C16H16BrClN2/c17-15-8-13(18)5-4-12(15)9-20-7-6-11-2-1-3-16(19)14(11)10-20/h1-5,8H,6-7,9-10,19H2 |
| InChIKey | TXLGDTHRNGGTGF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|