C14H14Br2N2S — CID 102841985
2-[(4,5-dibromothiophen-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 102841985) has the molecular formula C14H14Br2N2S and a molecular weight of 402.16 g/mol. Its IUPAC name is 2-[(4,5-dibromothiophen-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine.
| Compound Name | 2-[(4,5-dibromothiophen-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine |
|---|---|
| PubChem CID | 102841985 |
| Molecular Formula | C14H14Br2N2S |
| Molecular Weight | 402.16 g/mol |
| Exact Mass | 399.92 |
| IUPAC Name | 2-[(4,5-dibromothiophen-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | Nc1cccc2c1CN(Cc1cc(Br)c(Br)s1)CC2 |
| InChI | InChI=1S/C14H14Br2N2S/c15-12-6-10(19-14(12)16)7-18-5-4-9-2-1-3-13(17)11(9)8-18/h1-3,6H,4-5,7-8,17H2 |
| InChIKey | JHPLJLGEINZWKM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.16 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|