C15H19BrN4 — CID 114524104
2-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 114524104) has the molecular formula C15H19BrN4 and a molecular weight of 335.25 g/mol. Its IUPAC name is 2-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine.
| Compound Name | 2-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine |
|---|---|
| PubChem CID | 114524104 |
| Molecular Formula | C15H19BrN4 |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 2-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | Cc1nn(C)c(CN2CCc3cccc(N)c3C2)c1Br |
| InChI | InChI=1S/C15H19BrN4/c1-10-15(16)14(19(2)18-10)9-20-7-6-11-4-3-5-13(17)12(11)8-20/h3-5H,6-9,17H2,1-2H3 |
| InChIKey | QWGRDWSUQXRIMW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|