C16H21ClN4 — CID 118705147
2-[(4-amino-3-methyl-2-pyridinyl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine;hydrochloride (PubChem CID 118705147) has the molecular formula C16H21ClN4 and a molecular weight of 304.83 g/mol. Its IUPAC name is 2-[(4-amino-3-methyl-2-pyridinyl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine;hydrochloride.
| Compound Name | 2-[(4-amino-3-methyl-2-pyridinyl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine;hydrochloride |
|---|---|
| PubChem CID | 118705147 |
| Molecular Formula | C16H21ClN4 |
| Molecular Weight | 304.83 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-[(4-amino-3-methyl-2-pyridinyl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine;hydrochloride |
| SMILES | Cc1c(N)ccnc1CN1CCc2cccc(N)c2C1.Cl |
| InChI | InChI=1S/C16H20N4.ClH/c1-11-14(17)5-7-19-16(11)10-20-8-6-12-3-2-4-15(18)13(12)9-20;/h2-5,7H,6,8-10,18H2,1H3,(H2,17,19);1H |
| InChIKey | IOSWOTOGVJJTGK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.83 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|