C17H14N2O2 — CID 61151051
3-(3,5-dihydro-2H-1,4-benzoxazepine-4-carbonyl)benzonitrile (PubChem CID 61151051) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-(3,5-dihydro-2H-1,4-benzoxazepine-4-carbonyl)benzonitrile.
| Compound Name | 3-(3,5-dihydro-2H-1,4-benzoxazepine-4-carbonyl)benzonitrile |
|---|---|
| PubChem CID | 61151051 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-(3,5-dihydro-2H-1,4-benzoxazepine-4-carbonyl)benzonitrile |
| SMILES | N#Cc1cccc(C(=O)N2CCOc3ccccc3C2)c1 |
| InChI | InChI=1S/C17H14N2O2/c18-11-13-4-3-6-14(10-13)17(20)19-8-9-21-16-7-2-1-5-15(16)12-19/h1-7,10H,8-9,12H2 |
| InChIKey | UTUWRCCVEPGDMY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |