C10H15N3O — CID 19577577
(1-methylpyrazol-3-yl)-piperidin-1-ylmethanone (PubChem CID 19577577) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is (1-methylpyrazol-3-yl)-piperidin-1-ylmethanone.
| Compound Name | (1-methylpyrazol-3-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 19577577 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | (1-methylpyrazol-3-yl)-piperidin-1-ylmethanone |
| SMILES | Cn1ccc(C(=O)N2CCCCC2)n1 |
| InChI | InChI=1S/C10H15N3O/c1-12-8-5-9(11-12)10(14)13-6-3-2-4-7-13/h5,8H,2-4,6-7H2,1H3 |
| InChIKey | VRQONWOQRRQFFU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |