C9H13N3O — CID 123809651
(3-methylazetidin-1-yl)-(1-methylpyrazol-3-yl)methanone (PubChem CID 123809651) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is (3-methylazetidin-1-yl)-(1-methylpyrazol-3-yl)methanone.
| Compound Name | (3-methylazetidin-1-yl)-(1-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 123809651 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (3-methylazetidin-1-yl)-(1-methylpyrazol-3-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccn(C)n2)C1 |
| InChI | InChI=1S/C9H13N3O/c1-7-5-12(6-7)9(13)8-3-4-11(2)10-8/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | YTGDSTVLAZNVSP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |