C10H11Cl2N3O2S — CID 107963606
1-(2,5-dichlorothiophene-3-carbonyl)piperazine-2-carboxamide (PubChem CID 107963606) has the molecular formula C10H11Cl2N3O2S and a molecular weight of 308.19 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophene-3-carbonyl)piperazine-2-carboxamide.
| Compound Name | 1-(2,5-dichlorothiophene-3-carbonyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 107963606 |
| Molecular Formula | C10H11Cl2N3O2S |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 1-(2,5-dichlorothiophene-3-carbonyl)piperazine-2-carboxamide |
| SMILES | NC(=O)C1CNCCN1C(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H11Cl2N3O2S/c11-7-3-5(8(12)18-7)10(17)15-2-1-14-4-6(15)9(13)16/h3,6,14H,1-2,4H2,(H2,13,16) |
| InChIKey | DAAAYPOILQGDEZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |